C12H18ClNO2 — CID 116952676
2-chloro-1-(2,4-dimethoxy-6-methylphenyl)-N-methylethanamine (PubChem CID 116952676) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is 2-chloro-1-(2,4-dimethoxy-6-methylphenyl)-N-methylethanamine.
| Compound Name | 2-chloro-1-(2,4-dimethoxy-6-methylphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 116952676 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-chloro-1-(2,4-dimethoxy-6-methylphenyl)-N-methylethanamine |
| SMILES | CNC(CCl)c1c(C)cc(OC)cc1OC |
| InChI | InChI=1S/C12H18ClNO2/c1-8-5-9(15-3)6-11(16-4)12(8)10(7-13)14-2/h5-6,10,14H,7H2,1-4H3 |
| InChIKey | MRERXYXUYJPRLM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|