C12H17Cl2NO — CID 116952629
2-chloro-1-(3-chloro-6-methoxy-2,4-dimethylphenyl)-N-methylethanamine (PubChem CID 116952629) has the molecular formula C12H17Cl2NO and a molecular weight of 262.18 g/mol. Its IUPAC name is 2-chloro-1-(3-chloro-6-methoxy-2,4-dimethylphenyl)-N-methylethanamine.
| Compound Name | 2-chloro-1-(3-chloro-6-methoxy-2,4-dimethylphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 116952629 |
| Molecular Formula | C12H17Cl2NO |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-chloro-1-(3-chloro-6-methoxy-2,4-dimethylphenyl)-N-methylethanamine |
| SMILES | CNC(CCl)c1c(OC)cc(C)c(Cl)c1C |
| InChI | InChI=1S/C12H17Cl2NO/c1-7-5-10(16-4)11(8(2)12(7)14)9(6-13)15-3/h5,9,15H,6H2,1-4H3 |
| InChIKey | XCCYAESNLXQODN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|