C11H15Cl2NO — CID 116937561
2-chloro-1-(3-chloro-6-methoxy-2,4-dimethylphenyl)ethanamine (PubChem CID 116937561) has the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. Its IUPAC name is 2-chloro-1-(3-chloro-6-methoxy-2,4-dimethylphenyl)ethanamine.
| Compound Name | 2-chloro-1-(3-chloro-6-methoxy-2,4-dimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 116937561 |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-chloro-1-(3-chloro-6-methoxy-2,4-dimethylphenyl)ethanamine |
| SMILES | COc1cc(C)c(Cl)c(C)c1C(N)CCl |
| InChI | InChI=1S/C11H15Cl2NO/c1-6-4-9(15-3)10(8(14)5-12)7(2)11(6)13/h4,8H,5,14H2,1-3H3 |
| InChIKey | GOQIXNRTMYNUMG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|