C11H16ClNO2 — CID 84693134
2-amino-1-(3-chloro-4-methoxy-2,6-dimethylphenyl)ethanol (PubChem CID 84693134) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 2-amino-1-(3-chloro-4-methoxy-2,6-dimethylphenyl)ethanol.
| Compound Name | 2-amino-1-(3-chloro-4-methoxy-2,6-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 84693134 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-amino-1-(3-chloro-4-methoxy-2,6-dimethylphenyl)ethanol |
| SMILES | COc1cc(C)c(C(O)CN)c(C)c1Cl |
| InChI | InChI=1S/C11H16ClNO2/c1-6-4-9(15-3)11(12)7(2)10(6)8(14)5-13/h4,8,14H,5,13H2,1-3H3 |
| InChIKey | MVUBONBDYYIMFK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |