C10H14ClNO4 — CID 117372422
3-(2-amino-1-hydroxyethyl)-2-chloro-4,5-dimethoxyphenol (PubChem CID 117372422) has the molecular formula C10H14ClNO4 and a molecular weight of 247.68 g/mol. Its IUPAC name is 3-(2-amino-1-hydroxyethyl)-2-chloro-4,5-dimethoxyphenol.
| Compound Name | 3-(2-amino-1-hydroxyethyl)-2-chloro-4,5-dimethoxyphenol |
|---|---|
| PubChem CID | 117372422 |
| Molecular Formula | C10H14ClNO4 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 3-(2-amino-1-hydroxyethyl)-2-chloro-4,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(Cl)c(C(O)CN)c1OC |
| InChI | InChI=1S/C10H14ClNO4/c1-15-7-3-5(13)9(11)8(6(14)4-12)10(7)16-2/h3,6,13-14H,4,12H2,1-2H3 |
| InChIKey | ICICVULIZCTSLX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |