C10H15NO4 — CID 84679635
2-(2-amino-1-hydroxyethyl)-3,4-dimethoxyphenol (PubChem CID 84679635) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-(2-amino-1-hydroxyethyl)-3,4-dimethoxyphenol.
| Compound Name | 2-(2-amino-1-hydroxyethyl)-3,4-dimethoxyphenol |
|---|---|
| PubChem CID | 84679635 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-(2-amino-1-hydroxyethyl)-3,4-dimethoxyphenol |
| SMILES | COc1ccc(O)c(C(O)CN)c1OC |
| InChI | InChI=1S/C10H15NO4/c1-14-8-4-3-6(12)9(7(13)5-11)10(8)15-2/h3-4,7,12-13H,5,11H2,1-2H3 |
| InChIKey | CUGUKKGROISSAR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |