C10H13BrFNO3 — CID 117474367
2-amino-1-(3-bromo-2-fluoro-5,6-dimethoxyphenyl)ethanol (PubChem CID 117474367) has the molecular formula C10H13BrFNO3 and a molecular weight of 294.12 g/mol. Its IUPAC name is 2-amino-1-(3-bromo-2-fluoro-5,6-dimethoxyphenyl)ethanol.
| Compound Name | 2-amino-1-(3-bromo-2-fluoro-5,6-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 117474367 |
| Molecular Formula | C10H13BrFNO3 |
| Molecular Weight | 294.12 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 2-amino-1-(3-bromo-2-fluoro-5,6-dimethoxyphenyl)ethanol |
| SMILES | COc1cc(Br)c(F)c(C(O)CN)c1OC |
| InChI | InChI=1S/C10H13BrFNO3/c1-15-7-3-5(11)9(12)8(6(14)4-13)10(7)16-2/h3,6,14H,4,13H2,1-2H3 |
| InChIKey | DXJNVBBSNZNZRP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.12 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |