C10H12Cl2O — CID 22754053
2-chloro-4-(chloromethyl)-1-methoxy-3,5-dimethylbenzene (PubChem CID 22754053) has the molecular formula C10H12Cl2O and a molecular weight of 219.11 g/mol. Its IUPAC name is 2-chloro-4-(chloromethyl)-1-methoxy-3,5-dimethylbenzene.
| Compound Name | 2-chloro-4-(chloromethyl)-1-methoxy-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 22754053 |
| Molecular Formula | C10H12Cl2O |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 2-chloro-4-(chloromethyl)-1-methoxy-3,5-dimethylbenzene |
| SMILES | COc1cc(C)c(CCl)c(C)c1Cl |
| InChI | InChI=1S/C10H12Cl2O/c1-6-4-9(13-3)10(12)7(2)8(6)5-11/h4H,5H2,1-3H3 |
| InChIKey | RLZQHDKCLDWWAJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|