C28H27Cl2OP — CID 88737504
3-chloro-4-(chloromethyl)-1-methoxy-2,5-dimethylbenzene;triphenylphosphane (PubChem CID 88737504) has the molecular formula C28H27Cl2OP and a molecular weight of 481.40 g/mol. Its IUPAC name is 3-chloro-4-(chloromethyl)-1-methoxy-2,5-dimethylbenzene;triphenylphosphane.
| Compound Name | 3-chloro-4-(chloromethyl)-1-methoxy-2,5-dimethylbenzene;triphenylphosphane |
|---|---|
| PubChem CID | 88737504 |
| Molecular Formula | C28H27Cl2OP |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 3-chloro-4-(chloromethyl)-1-methoxy-2,5-dimethylbenzene;triphenylphosphane |
| SMILES | COc1cc(C)c(CCl)c(Cl)c1C.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C10H12Cl2O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-6-4-9(13-3)7(2)10(12)8(6)5-11/h1-15H;4H,5H2,1-3H3 |
| InChIKey | OFQZLZSIMPHXCN-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|