C28H27ClOP+ — CID 86735157
(2-chloro-4-methoxy-3,6-dimethylphenyl)methyl-triphenylphosphanium (PubChem CID 86735157) has the molecular formula C28H27ClOP+ and a molecular weight of 445.95 g/mol. Its IUPAC name is (2-chloro-4-methoxy-3,6-dimethylphenyl)methyl-triphenylphosphanium.
| Compound Name | (2-chloro-4-methoxy-3,6-dimethylphenyl)methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 86735157 |
| Molecular Formula | C28H27ClOP+ |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (2-chloro-4-methoxy-3,6-dimethylphenyl)methyl-triphenylphosphanium |
| SMILES | COc1cc(C)c(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(Cl)c1C |
| InChI | InChI=1S/C28H27ClOP/c1-21-19-27(30-3)22(2)28(29)26(21)20-31(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-19H,20H2,1-3H3/q+1 |
| InChIKey | QNACMUINPRDHBI-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|