C26H22Cl2OP+ — CID 87899067
(2,6-dichloro-3-methoxyphenyl)methyl-triphenylphosphanium (PubChem CID 87899067) has the molecular formula C26H22Cl2OP+ and a molecular weight of 452.34 g/mol. Its IUPAC name is (2,6-dichloro-3-methoxyphenyl)methyl-triphenylphosphanium.
| Compound Name | (2,6-dichloro-3-methoxyphenyl)methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 87899067 |
| Molecular Formula | C26H22Cl2OP+ |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | (2,6-dichloro-3-methoxyphenyl)methyl-triphenylphosphanium |
| SMILES | COc1ccc(Cl)c(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c1Cl |
| InChI | InChI=1S/C26H22Cl2OP/c1-29-25-18-17-24(27)23(26(25)28)19-30(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-18H,19H2,1H3/q+1 |
| InChIKey | WKMNENTVZGDJIJ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|