C26H22Cl3OP — CID 86735150
(2,6-dichloro-4-methoxyphenyl)methyl-triphenylphosphanium chloride (PubChem CID 86735150) has the molecular formula C26H22Cl3OP and a molecular weight of 487.79 g/mol. Its IUPAC name is (2,6-dichloro-4-methoxyphenyl)methyl-triphenylphosphanium chloride.
| Compound Name | (2,6-dichloro-4-methoxyphenyl)methyl-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 86735150 |
| Molecular Formula | C26H22Cl3OP |
| Molecular Weight | 487.79 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | (2,6-dichloro-4-methoxyphenyl)methyl-triphenylphosphanium chloride |
| SMILES | COc1cc(Cl)c(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(Cl)c1.[Cl-] |
| InChI | InChI=1S/C26H22Cl2OP.ClH/c1-29-20-17-25(27)24(26(28)18-20)19-30(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23;/h2-18H,19H2,1H3;1H/q+1;/p-1 |
| InChIKey | ZHCHSHOTVMQENC-UHFFFAOYSA-M |
| XLogP | 3.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|