C28H28ClO3P — CID 10552678
triphenyl-[(3,4,5-trimethoxyphenyl)methyl]phosphanium chloride (PubChem CID 10552678) has the molecular formula C28H28ClO3P and a molecular weight of 478.96 g/mol. Its IUPAC name is triphenyl-[(3,4,5-trimethoxyphenyl)methyl]phosphanium chloride.
| Compound Name | triphenyl-[(3,4,5-trimethoxyphenyl)methyl]phosphanium chloride |
|---|---|
| PubChem CID | 10552678 |
| Molecular Formula | C28H28ClO3P |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | triphenyl-[(3,4,5-trimethoxyphenyl)methyl]phosphanium chloride |
| SMILES | COc1cc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc(OC)c1OC.[Cl-] |
| InChI | InChI=1S/C28H28O3P.ClH/c1-29-26-19-22(20-27(30-2)28(26)31-3)21-32(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25;/h4-20H,21H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UKSISPKRRVBOOL-UHFFFAOYSA-M |
| XLogP | 2.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|