C29H30O4P+ — CID 22381105
[3,4-bis(methoxymethoxy)phenyl]methyl-triphenylphosphanium (PubChem CID 22381105) has the molecular formula C29H30O4P+ and a molecular weight of 473.53 g/mol. Its IUPAC name is [3,4-bis(methoxymethoxy)phenyl]methyl-triphenylphosphanium.
| Compound Name | [3,4-bis(methoxymethoxy)phenyl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 22381105 |
| Molecular Formula | C29H30O4P+ |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | [3,4-bis(methoxymethoxy)phenyl]methyl-triphenylphosphanium |
| SMILES | COCOc1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1OCOC |
| InChI | InChI=1S/C29H30O4P/c1-30-22-32-28-19-18-24(20-29(28)33-23-31-2)21-34(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h3-20H,21-23H2,1-2H3/q+1 |
| InChIKey | SSWTXVBEXZBREU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|