C35H30BrO2P — CID 10674977
(7,8-dimethoxyphenanthren-2-yl)methyl-triphenylphosphanium bromide (PubChem CID 10674977) has the molecular formula C35H30BrO2P and a molecular weight of 593.50 g/mol. Its IUPAC name is (7,8-dimethoxyphenanthren-2-yl)methyl-triphenylphosphanium bromide.
| Compound Name | (7,8-dimethoxyphenanthren-2-yl)methyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 10674977 |
| Molecular Formula | C35H30BrO2P |
| Molecular Weight | 593.50 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | (7,8-dimethoxyphenanthren-2-yl)methyl-triphenylphosphanium bromide |
| SMILES | COc1ccc2c(ccc3cc(C[P+](c4ccccc4)(c4ccccc4)c4ccccc4)ccc32)c1OC.[Br-] |
| InChI | InChI=1S/C35H30O2P.BrH/c1-36-34-23-22-32-31-20-18-26(24-27(31)19-21-33(32)35(34)37-2)25-38(28-12-6-3-7-13-28,29-14-8-4-9-15-29)30-16-10-5-11-17-30;/h3-24H,25H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | YOAZDXSLTPBFHD-UHFFFAOYSA-M |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|