C21H22O5 — CID 167089470
6-[(2,3-dimethoxyphenoxy)methyl]-1,2-dimethoxynaphthalene (PubChem CID 167089470) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is 6-[(2,3-dimethoxyphenoxy)methyl]-1,2-dimethoxynaphthalene.
| Compound Name | 6-[(2,3-dimethoxyphenoxy)methyl]-1,2-dimethoxynaphthalene |
|---|---|
| PubChem CID | 167089470 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 6-[(2,3-dimethoxyphenoxy)methyl]-1,2-dimethoxynaphthalene |
| SMILES | COc1cccc(OCc2ccc3c(OC)c(OC)ccc3c2)c1OC |
| InChI | InChI=1S/C21H22O5/c1-22-17-6-5-7-19(21(17)25-4)26-13-14-8-10-16-15(12-14)9-11-18(23-2)20(16)24-3/h5-12H,13H2,1-4H3 |
| InChIKey | KWFKIUPODVHBIE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |