C62H66O6P2+2 — CID 101025478
[4-[8-[2,6-dimethoxy-4-(triphenylphosphaniumylmethyl)phenoxy]octoxy]-3,5-dimethoxyphenyl]methyl-triphenylphosphanium (PubChem CID 101025478) has the molecular formula C62H66O6P2+2 and a molecular weight of 969.15 g/mol. Its IUPAC name is [4-[8-[2,6-dimethoxy-4-(triphenylphosphaniumylmethyl)phenoxy]octoxy]-3,5-dimethoxyphenyl]methyl-triphenylphosphanium.
| Compound Name | [4-[8-[2,6-dimethoxy-4-(triphenylphosphaniumylmethyl)phenoxy]octoxy]-3,5-dimethoxyphenyl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 101025478 |
| Molecular Formula | C62H66O6P2+2 |
| Molecular Weight | 969.15 g/mol |
| Exact Mass | 968.43 |
| IUPAC Name | [4-[8-[2,6-dimethoxy-4-(triphenylphosphaniumylmethyl)phenoxy]octoxy]-3,5-dimethoxyphenyl]methyl-triphenylphosphanium |
| SMILES | COc1cc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc(OC)c1OCCCCCCCCOc1c(OC)cc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C62H66O6P2/c1-63-57-43-49(47-69(51-29-15-9-16-30-51,52-31-17-10-18-32-52)53-33-19-11-20-34-53)44-58(64-2)61(57)67-41-27-7-5-6-8-28-42-68-62-59(65-3)45-50(46-60(62)66-4)48-70(54-35-21-12-22-36-54,55-37-23-13-24-38-55)56-39-25-14-26-40-56/h9-26,29-40,43-46H,5-8,27-28,41-42,47-48H2,1-4H3/q+2 |
| InChIKey | SYGHCMLMTBMJOT-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.15 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|