C28H27Br2O2P — CID 158114324
[4-bromo-3-(2-methoxyethoxy)phenyl]methyl-triphenylphosphanium bromide (PubChem CID 158114324) has the molecular formula C28H27Br2O2P and a molecular weight of 586.30 g/mol. Its IUPAC name is [4-bromo-3-(2-methoxyethoxy)phenyl]methyl-triphenylphosphanium bromide.
| Compound Name | [4-bromo-3-(2-methoxyethoxy)phenyl]methyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 158114324 |
| Molecular Formula | C28H27Br2O2P |
| Molecular Weight | 586.30 g/mol |
| Exact Mass | 584.01 |
| IUPAC Name | [4-bromo-3-(2-methoxyethoxy)phenyl]methyl-triphenylphosphanium bromide |
| SMILES | COCCOc1cc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)ccc1Br.[Br-] |
| InChI | InChI=1S/C28H27BrO2P.BrH/c1-30-19-20-31-28-21-23(17-18-27(28)29)22-32(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26;/h2-18,21H,19-20,22H2,1H3;1H/q+1;/p-1 |
| InChIKey | FQUSYZRVFXEEQV-UHFFFAOYSA-M |
| XLogP | 2.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|