C28H28O2P+ — CID 161133355
(3,5-dimethoxy-4-methylphenyl)methyl-triphenylphosphanium (PubChem CID 161133355) has the molecular formula C28H28O2P+ and a molecular weight of 427.50 g/mol. Its IUPAC name is (3,5-dimethoxy-4-methylphenyl)methyl-triphenylphosphanium.
| Compound Name | (3,5-dimethoxy-4-methylphenyl)methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 161133355 |
| Molecular Formula | C28H28O2P+ |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (3,5-dimethoxy-4-methylphenyl)methyl-triphenylphosphanium |
| SMILES | COc1cc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc(OC)c1C |
| InChI | InChI=1S/C28H28O2P/c1-22-27(29-2)19-23(20-28(22)30-3)21-31(24-13-7-4-8-14-24,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-20H,21H2,1-3H3/q+1 |
| InChIKey | ZBWOBOLSDKBBKT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|