C27H24Br2ClOP — CID 88763718
(2,6-dibromo-4-methoxy-3-methylphenyl)methyl-triphenylphosphanium chloride (PubChem CID 88763718) has the molecular formula C27H24Br2ClOP and a molecular weight of 590.72 g/mol. Its IUPAC name is (2,6-dibromo-4-methoxy-3-methylphenyl)methyl-triphenylphosphanium chloride.
| Compound Name | (2,6-dibromo-4-methoxy-3-methylphenyl)methyl-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 88763718 |
| Molecular Formula | C27H24Br2ClOP |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 587.96 |
| IUPAC Name | (2,6-dibromo-4-methoxy-3-methylphenyl)methyl-triphenylphosphanium chloride |
| SMILES | COc1cc(Br)c(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(Br)c1C.[Cl-] |
| InChI | InChI=1S/C27H24Br2OP.ClH/c1-20-26(30-2)18-25(28)24(27(20)29)19-31(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23;/h3-18H,19H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | YNBJMSWPOSWJFY-UHFFFAOYSA-M |
| XLogP | 4.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|