C31H34OP+ — CID 86735910
triphenyl-[(2,3,6-trimethyl-4-propoxyphenyl)methyl]phosphanium (PubChem CID 86735910) has the molecular formula C31H34OP+ and a molecular weight of 453.59 g/mol. Its IUPAC name is triphenyl-[(2,3,6-trimethyl-4-propoxyphenyl)methyl]phosphanium.
| Compound Name | triphenyl-[(2,3,6-trimethyl-4-propoxyphenyl)methyl]phosphanium |
|---|---|
| PubChem CID | 86735910 |
| Molecular Formula | C31H34OP+ |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | triphenyl-[(2,3,6-trimethyl-4-propoxyphenyl)methyl]phosphanium |
| SMILES | CCCOc1cc(C)c(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C31H34OP/c1-5-21-32-31-22-24(2)30(25(3)26(31)4)23-33(27-15-9-6-10-16-27,28-17-11-7-12-18-28)29-19-13-8-14-20-29/h6-20,22H,5,21,23H2,1-4H3/q+1 |
| InChIKey | OYMJYAUFRVVOCT-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|