C18H27N3O — CID 112719331
1-ethyl-4-[2-(2,3,6-trimethyl-4-propoxyphenyl)ethyl]triazole (PubChem CID 112719331) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is 1-ethyl-4-[2-(2,3,6-trimethyl-4-propoxyphenyl)ethyl]triazole.
| Compound Name | 1-ethyl-4-[2-(2,3,6-trimethyl-4-propoxyphenyl)ethyl]triazole |
|---|---|
| PubChem CID | 112719331 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 1-ethyl-4-[2-(2,3,6-trimethyl-4-propoxyphenyl)ethyl]triazole |
| SMILES | CCCOc1cc(C)c(CCc2cn(CC)nn2)c(C)c1C |
| InChI | InChI=1S/C18H27N3O/c1-6-10-22-18-11-13(3)17(14(4)15(18)5)9-8-16-12-21(7-2)20-19-16/h11-12H,6-10H2,1-5H3 |
| InChIKey | VJKODPUYTJCQHG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |