C28H28OP+ — CID 87697377
(4-methoxy-2,3-dimethylphenyl)methyl-triphenylphosphanium (PubChem CID 87697377) has the molecular formula C28H28OP+ and a molecular weight of 411.51 g/mol. Its IUPAC name is (4-methoxy-2,3-dimethylphenyl)methyl-triphenylphosphanium.
| Compound Name | (4-methoxy-2,3-dimethylphenyl)methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 87697377 |
| Molecular Formula | C28H28OP+ |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (4-methoxy-2,3-dimethylphenyl)methyl-triphenylphosphanium |
| SMILES | COc1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C28H28OP/c1-22-23(2)28(29-3)20-19-24(22)21-30(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-20H,21H2,1-3H3/q+1 |
| InChIKey | HDRLIBOZXYVDCT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|