C34H26O3P+ — CID 51056134
(1-methoxy-9,10-dioxoanthracen-2-yl)methyl-triphenylphosphanium (PubChem CID 51056134) has the molecular formula C34H26O3P+ and a molecular weight of 513.55 g/mol. Its IUPAC name is (1-methoxy-9,10-dioxoanthracen-2-yl)methyl-triphenylphosphanium.
| Compound Name | (1-methoxy-9,10-dioxoanthracen-2-yl)methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 51056134 |
| Molecular Formula | C34H26O3P+ |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | (1-methoxy-9,10-dioxoanthracen-2-yl)methyl-triphenylphosphanium |
| SMILES | COc1c(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C34H26O3P/c1-37-34-24(21-22-30-31(34)33(36)29-20-12-11-19-28(29)32(30)35)23-38(25-13-5-2-6-14-25,26-15-7-3-8-16-26)27-17-9-4-10-18-27/h2-22H,23H2,1H3/q+1 |
| InChIKey | FSMYBJNUACFVBL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|