C17H12BrClO4 — CID 54576987
2-(bromomethyl)-3-chloro-1,4-dimethoxyanthracene-9,10-dione (PubChem CID 54576987) has the molecular formula C17H12BrClO4 and a molecular weight of 395.64 g/mol. Its IUPAC name is 2-(bromomethyl)-3-chloro-1,4-dimethoxyanthracene-9,10-dione.
| Compound Name | 2-(bromomethyl)-3-chloro-1,4-dimethoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 54576987 |
| Molecular Formula | C17H12BrClO4 |
| Molecular Weight | 395.64 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | 2-(bromomethyl)-3-chloro-1,4-dimethoxyanthracene-9,10-dione |
| SMILES | COc1c(Cl)c(CBr)c(OC)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H12BrClO4/c1-22-16-10(7-18)13(19)17(23-2)12-11(16)14(20)8-5-3-4-6-9(8)15(12)21/h3-6H,7H2,1-2H3 |
| InChIKey | BQMAMOLPHCOAPC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|