C17H12N2O4 — CID 135461959
4,11-dimethoxy-2H-naphtho[2,3-f]indazole-5,10-dione (PubChem CID 135461959) has the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. Its IUPAC name is 4,11-dimethoxy-2H-naphtho[2,3-f]indazole-5,10-dione.
| Compound Name | 4,11-dimethoxy-2H-naphtho[2,3-f]indazole-5,10-dione |
|---|---|
| PubChem CID | 135461959 |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4,11-dimethoxy-2H-naphtho[2,3-f]indazole-5,10-dione |
| SMILES | COc1c2c(c(OC)c3n[nH]cc13)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H12N2O4/c1-22-16-10-7-18-19-13(10)17(23-2)12-11(16)14(20)8-5-3-4-6-9(8)15(12)21/h3-7H,1-2H3,(H,18,19) |
| InChIKey | IIUBPOIRXGADPD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|