C19H13NO2 — CID 12033898
1-methoxy-3-phenylindeno[2,1-c]pyridin-9-one (PubChem CID 12033898) has the molecular formula C19H13NO2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-methoxy-3-phenylindeno[2,1-c]pyridin-9-one.
| Compound Name | 1-methoxy-3-phenylindeno[2,1-c]pyridin-9-one |
|---|---|
| PubChem CID | 12033898 |
| Molecular Formula | C19H13NO2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 1-methoxy-3-phenylindeno[2,1-c]pyridin-9-one |
| SMILES | COc1nc(-c2ccccc2)cc2c1C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C19H13NO2/c1-22-19-17-15(13-9-5-6-10-14(13)18(17)21)11-16(20-19)12-7-3-2-4-8-12/h2-11H,1H3 |
| InChIKey | DJDNBJZZKIBDRB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |