C20H13NO5 — CID 10569653
7,9-dihydroxy-4-methoxy-2-phenylbenzo[g]quinoline-5,10-dione (PubChem CID 10569653) has the molecular formula C20H13NO5 and a molecular weight of 347.33 g/mol. Its IUPAC name is 7,9-dihydroxy-4-methoxy-2-phenylbenzo[g]quinoline-5,10-dione.
| Compound Name | 7,9-dihydroxy-4-methoxy-2-phenylbenzo[g]quinoline-5,10-dione |
|---|---|
| PubChem CID | 10569653 |
| Molecular Formula | C20H13NO5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 7,9-dihydroxy-4-methoxy-2-phenylbenzo[g]quinoline-5,10-dione |
| SMILES | COc1cc(-c2ccccc2)nc2c1C(=O)c1cc(O)cc(O)c1C2=O |
| InChI | InChI=1S/C20H13NO5/c1-26-15-9-13(10-5-3-2-4-6-10)21-18-17(15)19(24)12-7-11(22)8-14(23)16(12)20(18)25/h2-9,22-23H,1H3 |
| InChIKey | PECDPXOAOIJWBV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|