C11H8O5 — CID 71713819
5,7-dihydroxy-2-methoxynaphthalene-1,4-dione (PubChem CID 71713819) has the molecular formula C11H8O5 and a molecular weight of 220.18 g/mol. Its IUPAC name is 5,7-dihydroxy-2-methoxynaphthalene-1,4-dione.
| Compound Name | 5,7-dihydroxy-2-methoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 71713819 |
| Molecular Formula | C11H8O5 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 5,7-dihydroxy-2-methoxynaphthalene-1,4-dione |
| SMILES | COC1=CC(=O)c2c(O)cc(O)cc2C1=O |
| InChI | InChI=1S/C11H8O5/c1-16-9-4-8(14)10-6(11(9)15)2-5(12)3-7(10)13/h2-4,12-13H,1H3 |
| InChIKey | RAFCFIBVJBDWPW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|