C16H10O6 — CID 44575201
2-(3,4-dihydroxyphenyl)-5,7-dihydroxynaphthalene-1,4-dione (PubChem CID 44575201) has the molecular formula C16H10O6 and a molecular weight of 298.25 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5,7-dihydroxynaphthalene-1,4-dione.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 44575201 |
| Molecular Formula | C16H10O6 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxynaphthalene-1,4-dione |
| SMILES | O=C1C(c2ccc(O)c(O)c2)=CC(=O)c2c(O)cc(O)cc21 |
| InChI | InChI=1S/C16H10O6/c17-8-4-10-15(13(20)5-8)14(21)6-9(16(10)22)7-1-2-11(18)12(19)3-7/h1-6,17-20H |
| InChIKey | WBSZQWVYIZRNQG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|