C16H9IO3 — CID 164618238
5-hydroxy-2-(3-iodophenyl)naphthalene-1,4-dione (PubChem CID 164618238) has the molecular formula C16H9IO3 and a molecular weight of 376.15 g/mol. Its IUPAC name is 5-hydroxy-2-(3-iodophenyl)naphthalene-1,4-dione.
| Compound Name | 5-hydroxy-2-(3-iodophenyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 164618238 |
| Molecular Formula | C16H9IO3 |
| Molecular Weight | 376.15 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | 5-hydroxy-2-(3-iodophenyl)naphthalene-1,4-dione |
| SMILES | O=C1C(c2cccc(I)c2)=CC(=O)c2c(O)cccc21 |
| InChI | InChI=1S/C16H9IO3/c17-10-4-1-3-9(7-10)12-8-14(19)15-11(16(12)20)5-2-6-13(15)18/h1-8,18H |
| InChIKey | OMNHETUTXPCQKF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.15 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|