C16H10O5 — CID 142635586
2-(3,4-dihydroxyphenyl)-5-hydroxynaphthalene-1,4-dione (PubChem CID 142635586) has the molecular formula C16H10O5 and a molecular weight of 282.25 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5-hydroxynaphthalene-1,4-dione.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5-hydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 142635586 |
| Molecular Formula | C16H10O5 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxynaphthalene-1,4-dione |
| SMILES | O=C1C(c2ccc(O)c(O)c2)=CC(=O)c2c(O)cccc21 |
| InChI | InChI=1S/C16H10O5/c17-11-5-4-8(6-13(11)19)10-7-14(20)15-9(16(10)21)2-1-3-12(15)18/h1-7,17-19H |
| InChIKey | GLQWKVDZQGKFNK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|