C14H14O3 — CID 14866885
2-tert-butyl-8-hydroxynaphthalene-1,4-dione (PubChem CID 14866885) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-tert-butyl-8-hydroxynaphthalene-1,4-dione.
| Compound Name | 2-tert-butyl-8-hydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 14866885 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-tert-butyl-8-hydroxynaphthalene-1,4-dione |
| SMILES | CC(C)(C)C1=CC(=O)c2cccc(O)c2C1=O |
| InChI | InChI=1S/C14H14O3/c1-14(2,3)9-7-11(16)8-5-4-6-10(15)12(8)13(9)17/h4-7,15H,1-3H3 |
| InChIKey | HLAQQSVESAPVHD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|