About 7-tert-butyl-2H-isoquinoline-3,5,8-trione
7-tert-butyl-2H-isoquinoline-3,5,8-trione (PubChem CID 71337595) has the molecular formula C13H13NO3
and a molecular weight of 231.25 g/mol. Its IUPAC name is 7-tert-butyl-2H-isoquinoline-3,5,8-trione.
Molecular Properties
| Compound Name | 7-tert-butyl-2H-isoquinoline-3,5,8-trione |
| PubChem CID | 71337595 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 7-tert-butyl-2H-isoquinoline-3,5,8-trione |
| SMILES | CC(C)(C)C1=CC(=O)c2cc(=O)[nH]cc2C1=O |
| InChI | InChI=1S/C13H13NO3/c1-13(2,3)9-5-10(15)7-4-11(16)14-6-8(7)12(9)17/h4-6H,1-3H3,(H,14,16) |
| InChIKey | GBGDEVKAAUPQPD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 7-tert-butyl-2H-isoquinoline-3,5,8-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-2H-isoquinoline-3,5,8-trione?
The IUPAC name of 7-tert-butyl-2H-isoquinoline-3,5,8-trione (CID 71337595) is 7-tert-butyl-2H-isoquinoline-3,5,8-trione.
What is the SMILES notation for 7-tert-butyl-2H-isoquinoline-3,5,8-trione?
The canonical SMILES for 7-tert-butyl-2H-isoquinoline-3,5,8-trione is CC(C)(C)C1=CC(=O)c2cc(=O)[nH]cc2C1=O.
What is the InChIKey of 7-tert-butyl-2H-isoquinoline-3,5,8-trione?
The InChIKey is GBGDEVKAAUPQPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c1-13(2,3)9-5-10(15)7-4-11(16)14-6-8(7)12(9)17/h4-6H,1-3H3,(H,14,16).
What are the key properties of 7-tert-butyl-2H-isoquinoline-3,5,8-trione?
7-tert-butyl-2H-isoquinoline-3,5,8-trione has a molecular weight of 231.25 g/mol, XLogP of 1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-2H-isoquinoline-3,5,8-trione is sourced from PubChem (CID 71337595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).