C26H36O3 — CID 165080492
2-tert-butyl-5-methyl-4-methylidenecyclohexa-2,5-dien-1-one;2,5-ditert-butylcyclohexa-2,5-diene-1,4-dione (PubChem CID 165080492) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is 2-tert-butyl-5-methyl-4-methylidenecyclohexa-2,5-dien-1-one;2,5-ditert-butylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-tert-butyl-5-methyl-4-methylidenecyclohexa-2,5-dien-1-one;2,5-ditert-butylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 165080492 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | 2-tert-butyl-5-methyl-4-methylidenecyclohexa-2,5-dien-1-one;2,5-ditert-butylcyclohexa-2,5-diene-1,4-dione |
| SMILES | C=C1C=C(C(C)(C)C)C(=O)C=C1C.CC(C)(C)C1=CC(=O)C(C(C)(C)C)=CC1=O |
| InChI | InChI=1S/C14H20O2.C12H16O/c1-13(2,3)9-7-12(16)10(8-11(9)15)14(4,5)6;1-8-6-10(12(3,4)5)11(13)7-9(8)2/h7-8H,1-6H3;6-7H,1H2,2-5H3 |
| InChIKey | VAJSJYIKXUORHU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|