C20H24O2 — CID 642463
3,5-ditert-butyl-2-phenylcyclohexa-2,5-diene-1,4-dione (PubChem CID 642463) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 3,5-ditert-butyl-2-phenylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3,5-ditert-butyl-2-phenylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 642463 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 3,5-ditert-butyl-2-phenylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)(C)C1=CC(=O)C(c2ccccc2)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C20H24O2/c1-19(2,3)14-12-15(21)16(13-10-8-7-9-11-13)17(18(14)22)20(4,5)6/h7-12H,1-6H3 |
| InChIKey | AGJZTUIXXZODHI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|