C18H11BrO2 — CID 150862590
3-bromo-2,5-diphenylcyclohexa-2,5-diene-1,4-dione (PubChem CID 150862590) has the molecular formula C18H11BrO2 and a molecular weight of 339.19 g/mol. Its IUPAC name is 3-bromo-2,5-diphenylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-bromo-2,5-diphenylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 150862590 |
| Molecular Formula | C18H11BrO2 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 3-bromo-2,5-diphenylcyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(c2ccccc2)C(=O)C(Br)=C1c1ccccc1 |
| InChI | InChI=1S/C18H11BrO2/c19-17-16(13-9-5-2-6-10-13)15(20)11-14(18(17)21)12-7-3-1-4-8-12/h1-11H |
| InChIKey | KSIYPAYPEIFLTP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|