C24H18O2 — CID 150304868
3-(4-methoxyphenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one (PubChem CID 150304868) has the molecular formula C24H18O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one.
| Compound Name | 3-(4-methoxyphenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 150304868 |
| Molecular Formula | C24H18O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 3-(4-methoxyphenyl)-2,5-diphenylcyclopenta-2,4-dien-1-one |
| SMILES | COc1ccc(C2=C(c3ccccc3)C(=O)C(c3ccccc3)=C2)cc1 |
| InChI | InChI=1S/C24H18O2/c1-26-20-14-12-18(13-15-20)21-16-22(17-8-4-2-5-9-17)24(25)23(21)19-10-6-3-7-11-19/h2-16H,1H3 |
| InChIKey | GKJKMOLEGVFRTK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|