C17H15NO2 — CID 56649060
4-(4-methoxyphenyl)-3-phenyl-1,2-dihydropyrrol-5-one (PubChem CID 56649060) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-phenyl-1,2-dihydropyrrol-5-one.
| Compound Name | 4-(4-methoxyphenyl)-3-phenyl-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 56649060 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-phenyl-1,2-dihydropyrrol-5-one |
| SMILES | COc1ccc(C2=C(c3ccccc3)CNC2=O)cc1 |
| InChI | InChI=1S/C17H15NO2/c1-20-14-9-7-13(8-10-14)16-15(11-18-17(16)19)12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,18,19) |
| InChIKey | BEEUIVYPKVPRRU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|