C29H22O6 — CID 163039669
5-methoxy-3,4-bis(4-methoxyphenyl)-7-phenyl-1-benzofuran-2,6-dione (PubChem CID 163039669) has the molecular formula C29H22O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is 5-methoxy-3,4-bis(4-methoxyphenyl)-7-phenyl-1-benzofuran-2,6-dione.
| Compound Name | 5-methoxy-3,4-bis(4-methoxyphenyl)-7-phenyl-1-benzofuran-2,6-dione |
|---|---|
| PubChem CID | 163039669 |
| Molecular Formula | C29H22O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 5-methoxy-3,4-bis(4-methoxyphenyl)-7-phenyl-1-benzofuran-2,6-dione |
| SMILES | COC1=C(c2ccc(OC)cc2)C2=C(c3ccc(OC)cc3)C(=O)OC2=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C29H22O6/c1-32-20-13-9-18(10-14-20)22-25-23(19-11-15-21(33-2)16-12-19)29(31)35-27(25)24(26(30)28(22)34-3)17-7-5-4-6-8-17/h4-16H,1-3H3 |
| InChIKey | BEPNZVMCLZUPKE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |