C25H20O6S — CID 160610749
(5Z)-5-[(2-hydroxyphenyl)methylidene]-3-(4-methoxyphenyl)-4-(4-methylsulfonylphenyl)furan-2-one (PubChem CID 160610749) has the molecular formula C25H20O6S and a molecular weight of 448.50 g/mol. Its IUPAC name is (5Z)-5-[(2-hydroxyphenyl)methylidene]-3-(4-methoxyphenyl)-4-(4-methylsulfonylphenyl)furan-2-one.
| Compound Name | (5Z)-5-[(2-hydroxyphenyl)methylidene]-3-(4-methoxyphenyl)-4-(4-methylsulfonylphenyl)furan-2-one |
|---|---|
| PubChem CID | 160610749 |
| Molecular Formula | C25H20O6S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | (5Z)-5-[(2-hydroxyphenyl)methylidene]-3-(4-methoxyphenyl)-4-(4-methylsulfonylphenyl)furan-2-one |
| SMILES | COc1ccc(C2=C(c3ccc(S(C)(=O)=O)cc3)/C(=C/c3ccccc3O)OC2=O)cc1 |
| InChI | InChI=1S/C25H20O6S/c1-30-19-11-7-17(8-12-19)24-23(16-9-13-20(14-10-16)32(2,28)29)22(31-25(24)27)15-18-5-3-4-6-21(18)26/h3-15,26H,1-2H3/b22-15- |
| InChIKey | RFMDCPQWVCYOQS-JCMHNJIXSA-N |
| XLogP | 4.31 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|