C25H19ClO6S — CID 71740479
(5Z)-3-(2-chlorophenyl)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-(4-methylsulfonylphenyl)furan-2-one (PubChem CID 71740479) has the molecular formula C25H19ClO6S and a molecular weight of 482.94 g/mol. Its IUPAC name is (5Z)-3-(2-chlorophenyl)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-(4-methylsulfonylphenyl)furan-2-one.
| Compound Name | (5Z)-3-(2-chlorophenyl)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-(4-methylsulfonylphenyl)furan-2-one |
|---|---|
| PubChem CID | 71740479 |
| Molecular Formula | C25H19ClO6S |
| Molecular Weight | 482.94 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | (5Z)-3-(2-chlorophenyl)-5-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-(4-methylsulfonylphenyl)furan-2-one |
| SMILES | COc1cc(/C=C2\OC(=O)C(c3ccccc3Cl)=C2c2ccc(S(C)(=O)=O)cc2)ccc1O |
| InChI | InChI=1S/C25H19ClO6S/c1-31-21-13-15(7-12-20(21)27)14-22-23(16-8-10-17(11-9-16)33(2,29)30)24(25(28)32-22)18-5-3-4-6-19(18)26/h3-14,27H,1-2H3/b22-14- |
| InChIKey | UMUZJYBQPSYQFS-HMAPJEAMSA-N |
| XLogP | 4.97 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.94 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|