C16H20O3S — CID 178021932
ethane;1-methoxy-4-(4-methylsulfonylphenyl)benzene (PubChem CID 178021932) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is ethane;1-methoxy-4-(4-methylsulfonylphenyl)benzene.
| Compound Name | ethane;1-methoxy-4-(4-methylsulfonylphenyl)benzene |
|---|---|
| PubChem CID | 178021932 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | ethane;1-methoxy-4-(4-methylsulfonylphenyl)benzene |
| SMILES | CC.COc1ccc(-c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C14H14O3S.C2H6/c1-17-13-7-3-11(4-8-13)12-5-9-14(10-6-12)18(2,15)16;1-2/h3-10H,1-2H3;1-2H3 |
| InChIKey | YIVQDJJYIYINDO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |