C20H22O3S — CID 174400263
1-methoxy-4-[[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]methyl]benzene (PubChem CID 174400263) has the molecular formula C20H22O3S and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-methoxy-4-[[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]methyl]benzene.
| Compound Name | 1-methoxy-4-[[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]methyl]benzene |
|---|---|
| PubChem CID | 174400263 |
| Molecular Formula | C20H22O3S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-methoxy-4-[[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]methyl]benzene |
| SMILES | COc1ccc(CC2=C(c3ccc(S(C)(=O)=O)cc3)CCC2)cc1 |
| InChI | InChI=1S/C20H22O3S/c1-23-18-10-6-15(7-11-18)14-17-4-3-5-20(17)16-8-12-19(13-9-16)24(2,21)22/h6-13H,3-5,14H2,1-2H3 |
| InChIKey | QUZKKRCZSPZMKP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |