C19H19FO3S — CID 22917666
1-fluoro-2-methoxy-4-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene (PubChem CID 22917666) has the molecular formula C19H19FO3S and a molecular weight of 346.42 g/mol. Its IUPAC name is 1-fluoro-2-methoxy-4-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene.
| Compound Name | 1-fluoro-2-methoxy-4-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene |
|---|---|
| PubChem CID | 22917666 |
| Molecular Formula | C19H19FO3S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-fluoro-2-methoxy-4-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene |
| SMILES | COc1cc(C2=C(c3ccc(S(C)(=O)=O)cc3)CCC2)ccc1F |
| InChI | InChI=1S/C19H19FO3S/c1-23-19-12-14(8-11-18(19)20)17-5-3-4-16(17)13-6-9-15(10-7-13)24(2,21)22/h6-12H,3-5H2,1-2H3 |
| InChIKey | FZYKFKXGTHFCSH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|