C18H16F3NO2S — CID 22917405
3-(difluoromethyl)-2-fluoro-5-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]pyridine (PubChem CID 22917405) has the molecular formula C18H16F3NO2S and a molecular weight of 367.39 g/mol. Its IUPAC name is 3-(difluoromethyl)-2-fluoro-5-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]pyridine.
| Compound Name | 3-(difluoromethyl)-2-fluoro-5-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]pyridine |
|---|---|
| PubChem CID | 22917405 |
| Molecular Formula | C18H16F3NO2S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 3-(difluoromethyl)-2-fluoro-5-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]pyridine |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3cnc(F)c(C(F)F)c3)CCC2)cc1 |
| InChI | InChI=1S/C18H16F3NO2S/c1-25(23,24)13-7-5-11(6-8-13)14-3-2-4-15(14)12-9-16(17(19)20)18(21)22-10-12/h5-10,17H,2-4H2,1H3 |
| InChIKey | KRSLENHUTLDSLL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|