C18H15ClF3NO2S — CID 22917418
2-chloro-5-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-3-(trifluoromethyl)pyridine (PubChem CID 22917418) has the molecular formula C18H15ClF3NO2S and a molecular weight of 401.84 g/mol. Its IUPAC name is 2-chloro-5-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-3-(trifluoromethyl)pyridine.
| Compound Name | 2-chloro-5-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 22917418 |
| Molecular Formula | C18H15ClF3NO2S |
| Molecular Weight | 401.84 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 2-chloro-5-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]-3-(trifluoromethyl)pyridine |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3cnc(Cl)c(C(F)(F)F)c3)CCC2)cc1 |
| InChI | InChI=1S/C18H15ClF3NO2S/c1-26(24,25)13-7-5-11(6-8-13)14-3-2-4-15(14)12-9-16(18(20,21)22)17(19)23-10-12/h5-10H,2-4H2,1H3 |
| InChIKey | YRHJTLOXOMBZFN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.84 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|