C19H17F3O2S — CID 22917318
2-(difluoromethyl)-1-fluoro-4-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene (PubChem CID 22917318) has the molecular formula C19H17F3O2S and a molecular weight of 366.40 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-fluoro-4-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene.
| Compound Name | 2-(difluoromethyl)-1-fluoro-4-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene |
|---|---|
| PubChem CID | 22917318 |
| Molecular Formula | C19H17F3O2S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-(difluoromethyl)-1-fluoro-4-[2-(4-methylsulfonylphenyl)cyclopenten-1-yl]benzene |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3ccc(F)c(C(F)F)c3)CCC2)cc1 |
| InChI | InChI=1S/C19H17F3O2S/c1-25(23,24)14-8-5-12(6-9-14)15-3-2-4-16(15)13-7-10-18(20)17(11-13)19(21)22/h5-11,19H,2-4H2,1H3 |
| InChIKey | LSHPAOOSNPWESP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|