C24H30ClFO2S — CID 142174476
6-(3-chloro-4-fluorophenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene;ethane (PubChem CID 142174476) has the molecular formula C24H30ClFO2S and a molecular weight of 437.02 g/mol. Its IUPAC name is 6-(3-chloro-4-fluorophenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene;ethane.
| Compound Name | 6-(3-chloro-4-fluorophenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene;ethane |
|---|---|
| PubChem CID | 142174476 |
| Molecular Formula | C24H30ClFO2S |
| Molecular Weight | 437.02 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 6-(3-chloro-4-fluorophenyl)-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene;ethane |
| SMILES | CC.CC.CS(=O)(=O)c1ccc(C2=C(c3ccc(F)c(Cl)c3)CC3(CC3)C2)cc1 |
| InChI | InChI=1S/C20H18ClFO2S.2C2H6/c1-25(23,24)15-5-2-13(3-6-15)16-11-20(8-9-20)12-17(16)14-4-7-19(22)18(21)10-14;2*1-2/h2-7,10H,8-9,11-12H2,1H3;2*1-2H3 |
| InChIKey | QRDQOPXHFBLQOU-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.02 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|