C21H22O2S — CID 18933961
7-(4-methylsulfonylphenyl)-6-phenylspiro[3.4]oct-6-ene (PubChem CID 18933961) has the molecular formula C21H22O2S and a molecular weight of 338.47 g/mol. Its IUPAC name is 7-(4-methylsulfonylphenyl)-6-phenylspiro[3.4]oct-6-ene.
| Compound Name | 7-(4-methylsulfonylphenyl)-6-phenylspiro[3.4]oct-6-ene |
|---|---|
| PubChem CID | 18933961 |
| Molecular Formula | C21H22O2S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 7-(4-methylsulfonylphenyl)-6-phenylspiro[3.4]oct-6-ene |
| SMILES | CS(=O)(=O)c1ccc(C2=C(c3ccccc3)CC3(CCC3)C2)cc1 |
| InChI | InChI=1S/C21H22O2S/c1-24(22,23)18-10-8-17(9-11-18)20-15-21(12-5-13-21)14-19(20)16-6-3-2-4-7-16/h2-4,6-11H,5,12-15H2,1H3 |
| InChIKey | PNSGNUIRUFQZOF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|